Compound Information | SONAR Target prediction | Name: | Amiprilose hydrochloride | Unique Identifier: | LOPAC 00658 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C14ClH28NO6 | Molecular Weight: | 313.606 g/mol | X log p: | -0.87 (online calculus) | Lipinksi Failures | 0 | TPSA | 40.16 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 7 | Rotatable Bond Count: | 7 | Canonical Smiles: | Cl.CN(C)CCCOC1C(OC2OC(C)(C)OC21)C(O)CO | Class: | Immune System | Action: | Modulator |
Species: |
4932 |
Condition: |
NOP16 |
Replicates: |
2 |
Raw OD Value: r im |
0.7427±0.0174655 |
Normalized OD Score: sc h |
1.0218±0.0130003 |
Z-Score: |
1.0549±0.727291 |
p-Value: |
0.352692 |
Z-Factor: |
-3.50209 |
Fitness Defect: |
1.0422 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 1|E8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-04-22 YYYY-MM-DD | Plate CH Control (+): | 0.045475±0.00045 | Plate DMSO Control (-): | 0.688625±0.23672 | Plate Z-Factor: | -0.3374 |
| png ps pdf |
5702213 |
1-[(3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-diol |
6420050 |
1-[(3R,4S,5S)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-diol hydrochloride |
6602490 |
(1S)-1-[(4S,5S)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-di ol |
6603708 |
(1R)-1-[(1S,3S,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane- 1,2-diol |
6604419 |
(1R)-1-[(1S,3R,4R,5S)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane- 1,2-diol |
6713980 |
1-[(3R,4S,5S)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-diol |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 11451 | Additional Members: 4 | Rows returned: 1 | |
|