| Compound Information | SONAR Target prediction | | Name: | Amiprilose hydrochloride | | Unique Identifier: | LOPAC 00658 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C14ClH28NO6 | | Molecular Weight: | 313.606 g/mol | | X log p: | -0.87 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 40.16 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 7 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | Cl.CN(C)CCCOC1C(OC2OC(C)(C)OC21)C(O)CO | | Class: | Immune System | | Action: | Modulator |
| Species: |
4932 |
| Condition: |
NOP13 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8497±0.199192 |
| Normalized OD Score: sc h |
1.0074±0.0149513 |
| Z-Score: |
0.2972±0.655473 |
| p-Value: |
0.657382 |
| Z-Factor: |
-4.51708 |
| Fitness Defect: |
0.4195 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 1|E8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-04-22 YYYY-MM-DD | | Plate CH Control (+): | 0.0587±0.00658 | | Plate DMSO Control (-): | 0.73055±0.25803 | | Plate Z-Factor: | -0.3563 |
|  png
ps
pdf |
| 5702213 |
1-[(3R,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-diol |
| 6420050 |
1-[(3R,4S,5S)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-diol
hydrochloride |
| 6602490 |
(1S)-1-[(4S,5S)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-di
ol |
| 6603708 |
(1R)-1-[(1S,3S,4S,5R)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-
1,2-diol |
| 6604419 |
(1R)-1-[(1S,3R,4R,5S)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-
1,2-diol |
| 6713980 |
1-[(3R,4S,5S)-4-(3-dimethylaminopropoxy)-7,7-dimethyl-2,6,8-trioxabicyclo[3.3.0]oct-3-yl]ethane-1,2-diol |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 11451 | Additional Members: 4 | Rows returned: 1 | |
|
