Compound Information | SONAR Target prediction | Name: | Apigenin | Unique Identifier: | LOPAC 00653 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H10O5 | Molecular Weight: | 260.158 g/mol | X log p: | 14.697 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 1 | Canonical Smiles: | Oc1ccc(cc1)C1Oc2cc(O)cc(O)c2C(=O)C=1 | Class: | Cell Cycle | Action: | Inhibitor |
Species: |
4932 |
Condition: |
NUM1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7420±0.00601041 |
Normalized OD Score: sc h |
1.0033±0.00446892 |
Z-Score: |
0.1867±0.255348 |
p-Value: |
0.854258 |
Z-Factor: |
-23.6358 |
Fitness Defect: |
0.1575 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 1|G6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.90 Celcius | Date: | 2005-11-30 YYYY-MM-DD | Plate CH Control (+): | 0.03905±0.00074 | Plate DMSO Control (-): | 0.7277±0.00884 | Plate Z-Factor: | 0.9543 |
| png ps pdf |
DBLink | Rows returned: 1 | |
5280443 |
5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 25 | << Back 1 2 3 4 5 |
active | Cluster 1884 | Additional Members: 20 | Rows returned: 6 | |
|