| Compound Information | SONAR Target prediction |  | Name: | Apigenin |  | Unique Identifier: | LOPAC 00653  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C15H10O5 |  | Molecular Weight: | 260.158 g/mol |  | X log p: | 14.697  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | Oc1ccc(cc1)C1Oc2cc(O)cc(O)c2C(=O)C=1 |  | Class: | Cell Cycle |  | Action: | Inhibitor |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		LGE1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.4754±0.00678822 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9853±0.00686359 | 
	 
	
		| Z-Score: | 
		-0.5063±0.250292 | 
	 
	
		| p-Value: | 
		0.618164 | 
	 
	
		| Z-Factor: | 
		-7.34377 | 
	 
	
		| Fitness Defect: | 
		0.481 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Lopac |  | Plate Number and Position: | 1|G6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.10 Celcius |  | Date: | 2005-11-29 YYYY-MM-DD |  | Plate CH Control (+): | 0.039525±0.00295 |  | Plate DMSO Control (-): | 0.472025±0.00919 |  | Plate Z-Factor: | 0.8920 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 1 |  |  
 
	
		| 5280443 | 
		5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 25 | << Back 1 2 3 4 5 |   
 |  active | Cluster 1884 | Additional Members: 20 | Rows returned: 6 |  |   
 
 |