Compound Information | SONAR Target prediction | Name: | Apigenin | Unique Identifier: | LOPAC 00653 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H10O5 | Molecular Weight: | 260.158 g/mol | X log p: | 14.697 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 1 | Canonical Smiles: | Oc1ccc(cc1)C1Oc2cc(O)cc(O)c2C(=O)C=1 | Class: | Cell Cycle | Action: | Inhibitor |
Species: |
4932 |
Condition: |
NOP16 |
Replicates: |
2 |
Raw OD Value: r im |
0.7229±0.00226274 |
Normalized OD Score: sc h |
0.9868±0.0117173 |
Z-Score: |
-0.6482±0.619934 |
p-Value: |
0.55553 |
Z-Factor: |
-4.26001 |
Fitness Defect: |
0.5878 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 1|G6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-04-22 YYYY-MM-DD | Plate CH Control (+): | 0.045475±0.00045 | Plate DMSO Control (-): | 0.688625±0.23672 | Plate Z-Factor: | -0.3374 |
| png ps pdf |
DBLink | Rows returned: 1 | |
5280443 |
5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
active | Cluster 1884 | Additional Members: 20 | Rows returned: 6 | |
|