| Compound Information | SONAR Target prediction | | Name: | Apigenin | | Unique Identifier: | LOPAC 00653 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H10O5 | | Molecular Weight: | 260.158 g/mol | | X log p: | 14.697 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1ccc(cc1)C1Oc2cc(O)cc(O)c2C(=O)C=1 | | Class: | Cell Cycle | | Action: | Inhibitor |
| Species: |
4932 |
| Condition: |
NOP13 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8597±0.213193 |
| Normalized OD Score: sc h |
1.0051±0.0306134 |
| Z-Score: |
0.1359±1.41066 |
| p-Value: |
0.322982 |
| Z-Factor: |
-4.81981 |
| Fitness Defect: |
1.1302 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 1|G6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-04-22 YYYY-MM-DD | | Plate CH Control (+): | 0.0587±0.00658 | | Plate DMSO Control (-): | 0.73055±0.25803 | | Plate Z-Factor: | -0.3563 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 5280443 |
5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| active | Cluster 1884 | Additional Members: 20 | Rows returned: 6 | |
|
