Compound Information | SONAR Target prediction | Name: | (±)-Norepinephrine (+)bitartrate | Unique Identifier: | LOPAC 00648 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C12H17NO9 | Molecular Weight: | 302.13 g/mol | X log p: | 5.748 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 2 | Canonical Smiles: | NCC(O)c1ccc(O)c(O)c1.OC(C(O)C(O)=O)C(O)=O | Class: | Adrenoceptor | Action: | Agonist |
Species: |
4932 |
Condition: |
PAC10 |
Replicates: |
2 |
Raw OD Value: r im |
0.8036±0.00480833 |
Normalized OD Score: sc h |
1.0043±0.00242934 |
Z-Score: |
0.1944±0.112935 |
p-Value: |
0.846344 |
Z-Factor: |
-13.5817 |
Fitness Defect: |
0.1668 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 1|F4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.50 Celcius | Date: | 2005-04-15 YYYY-MM-DD | Plate CH Control (+): | 0.04345±0.00828 | Plate DMSO Control (-): | 0.75095±0.02945 | Plate Z-Factor: | 0.9179 |
| png ps pdf |
5813 |
4-(2-amino-1-hydroxy-ethyl)benzene-1,2-diol; (2R,3R)-2,3-dihydroxybutanedioic acid |
165118 |
4-(2-amino-1-hydroxy-ethyl)benzene-1,2-diol; (2R,3R)-2,3-dihydroxybutanedioate |
168929 |
4-[(1S)-2-amino-1-hydroxy-ethyl]benzene-1,2-diol; (2R,3R)-2,3-dihydroxybutanedioic acid |
297812 |
4-(2-amino-1-hydroxy-ethyl)benzene-1,2-diol; 2,3-dihydroxybutanedioic acid |
517292 |
[2-(3,4-dihydroxyphenyl)-2-hydroxy-ethyl]azanium; 2,3,4-trihydroxy-4-oxo-butanoate; hydrate |
3047796 |
4-[(1R)-2-amino-1-hydroxy-ethyl]benzene-1,2-diol; (2R,3R)-2,3-dihydroxybutanedioic acid; hydrate |
internal high similarity DBLink | Rows returned: 3 | |
nonactive | Cluster 15753 | Additional Members: 7 | Rows returned: 6 | |
|