| Compound Information | SONAR Target prediction | | Name: | (±)-Norepinephrine (+)bitartrate | | Unique Identifier: | LOPAC 00648 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C12H17NO9 | | Molecular Weight: | 302.13 g/mol | | X log p: | 5.748 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | NCC(O)c1ccc(O)c(O)c1.OC(C(O)C(O)=O)C(O)=O | | Class: | Adrenoceptor | | Action: | Agonist |
| Species: |
4932 |
| Condition: |
NOP16 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7539±0.0180312 |
| Normalized OD Score: sc h |
1.0213±0.0171648 |
| Z-Score: |
1.0409±0.918888 |
| p-Value: |
0.393306 |
| Z-Factor: |
-3.56509 |
| Fitness Defect: |
0.9332 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 1|F4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-04-22 YYYY-MM-DD | | Plate CH Control (+): | 0.045475±0.00045 | | Plate DMSO Control (-): | 0.688625±0.23672 | | Plate Z-Factor: | -0.3374 |
|  png
ps
pdf |
| 5813 |
4-(2-amino-1-hydroxy-ethyl)benzene-1,2-diol; (2R,3R)-2,3-dihydroxybutanedioic acid |
| 165118 |
4-(2-amino-1-hydroxy-ethyl)benzene-1,2-diol; (2R,3R)-2,3-dihydroxybutanedioate |
| 168929 |
4-[(1S)-2-amino-1-hydroxy-ethyl]benzene-1,2-diol; (2R,3R)-2,3-dihydroxybutanedioic acid |
| 297812 |
4-(2-amino-1-hydroxy-ethyl)benzene-1,2-diol; 2,3-dihydroxybutanedioic acid |
| 517292 |
[2-(3,4-dihydroxyphenyl)-2-hydroxy-ethyl]azanium; 2,3,4-trihydroxy-4-oxo-butanoate; hydrate |
| 3047796 |
4-[(1R)-2-amino-1-hydroxy-ethyl]benzene-1,2-diol; (2R,3R)-2,3-dihydroxybutanedioic acid; hydrate |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 15753 | Additional Members: 7 | Rows returned: 2 | |
|
