Compound Information | SONAR Target prediction | Name: | (±)-Norepinephrine (+)bitartrate | Unique Identifier: | LOPAC 00648 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C12H17NO9 | Molecular Weight: | 302.13 g/mol | X log p: | 5.748 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 2 | Canonical Smiles: | NCC(O)c1ccc(O)c(O)c1.OC(C(O)C(O)=O)C(O)=O | Class: | Adrenoceptor | Action: | Agonist |
Species: |
4932 |
Condition: |
TEP1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5904±0.0026163 |
Normalized OD Score: sc h |
1.0026±0.00107739 |
Z-Score: |
0.1000±0.0261992 |
p-Value: |
0.920394 |
Z-Factor: |
-12.438 |
Fitness Defect: |
0.083 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 1|F4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-05-17 YYYY-MM-DD | Plate CH Control (+): | 0.045274999999999996±0.00138 | Plate DMSO Control (-): | 0.56525±0.01860 | Plate Z-Factor: | 0.9037 |
| png ps pdf |
6604057 |
4-[(1R)-2-amino-1-hydroxy-ethyl]benzene-1,2-diol; (2S,3R)-2,3-dihydroxybutanedioic acid |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 15753 | Additional Members: 7 | Rows returned: 2 | |
|