| Compound Information | SONAR Target prediction | | Name: | (±)-Norepinephrine (+)bitartrate | | Unique Identifier: | LOPAC 00648 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C12H17NO9 | | Molecular Weight: | 302.13 g/mol | | X log p: | 5.748 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | NCC(O)c1ccc(O)c(O)c1.OC(C(O)C(O)=O)C(O)=O | | Class: | Adrenoceptor | | Action: | Agonist |
| Species: |
4932 |
| Condition: |
SQS1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7930±0.0464569 |
| Normalized OD Score: sc h |
0.9873±0.022114 |
| Z-Score: |
-0.5107±0.964892 |
| p-Value: |
0.548316 |
| Z-Factor: |
-11.5802 |
| Fitness Defect: |
0.6009 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 1|F4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-05-21 YYYY-MM-DD | | Plate CH Control (+): | 0.049374999999999995±0.00463 | | Plate DMSO Control (-): | 0.763875±0.02664 | | Plate Z-Factor: | 0.8901 |
|  png
ps
pdf |
| 6604057 |
4-[(1R)-2-amino-1-hydroxy-ethyl]benzene-1,2-diol; (2S,3R)-2,3-dihydroxybutanedioic acid |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 15753 | Additional Members: 7 | Rows returned: 2 | |
|
