| Compound Information | SONAR Target prediction |
| Name: | 3-Iodo-L-tyrosine |
| Unique Identifier: | LOPAC 00584 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C9H10INO3 |
| Molecular Weight: | 298.014 g/mol |
| X log p: | 5.784 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 17.07 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 4 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | NC(Cc1ccc(O)c(I)c1)C(O)=O |
| Class: | Neurotransmission |
| Action: | Inhibitor |
| Selectivity: | Tyrosine hydroxylase |
| Generic_name: | 3-IODO-TYROSINE |
| Chemical_iupac_name: | 3-IODO-TYROSINE |
| Drug_type: | Experimental |
| Drugbank_id: | EXPT01951 |
| Drug_category: | Sst1-Selective Somatosatin Analog inhibitor |
| Organisms_affected: | -1 |
| Found: 24 nonactive as graph: single | with analogs | [1] << Back 1 2 3 4 5 6 7 8 9 10 Next >> [24] |
| Species: | 4932 |
| Condition: | GAS1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6940±0.0145664 |
| Normalized OD Score: sc h | 0.9922±0.0041665 |
| Z-Score: | -0.3748±0.199555 |
| p-Value: | 0.710542 |
| Z-Factor: | -5.34998 |
| Fitness Defect: | 0.3417 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 8 | 1 2 Next >> |
| 6272 | 2-amino-3-(4-hydroxy-3-iodo-phenyl)propanoic acid |
| 123751 | 2-amino-3-(4-hydroxy-3-iodo-phenyl)-2-methyl-propanoic acid |
| 172981 | (2S)-2-amino-3-(4-hydroxy-3-iodo-phenyl)propanoic acid |
| 439744 | (2S)-2-amino-3-(4-hydroxy-3-iodo-phenyl)propanoic acid |
| 450432 | (2R)-2-amino-3-(4-hydroxy-3-iodo-phenyl)-2-methyl-propanoic acid |
| 450433 | (2R)-2-amino-3-(4-hydroxy-3-iodo-phenyl)-2-methyl-propanoic acid |
| internal high similarity DBLink | Rows returned: 0 |
| nonactive | Cluster 12980 | Additional Members: 10 | Rows returned: 7 | 1 2 Next >> |
| SPE01502206 | 0.55 |
| LOPAC 01089 | 0.55 |
| LOPAC 00822 | 0.365853658536585 |
| SPE02300205 | 0 |
| LAT005E02 | 0 |
| Prest185 | 0 |
Service provided by the
Mike Tyers Laboratory