| Compound Information | SONAR Target prediction |
| Name: | DL-alpha-Methyl-p-tyrosine |
| Unique Identifier: | LOPAC 00581 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C10H13NO3 |
| Molecular Weight: | 182.112 g/mol |
| X log p: | 6.28 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 17.07 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 4 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | CC(N)(Cc1ccc(O)cc1)C(O)=O |
| Class: | Neurotransmission |
| Action: | Inhibitor |
| Selectivity: | Tyrosine hydroxylase |
| Generic_name: | Metyrosine |
| Chemical_iupac_name: | 2-amino-3-(4-hydroxyphenyl)-2-methyl-propanoic acid |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA450487 |
| Kegg_compound_id: | C07921 |
| Drugbank_id: | APRD01112 |
| Melting_point: | 312.5 oC |
| H2o_solubility: | Very slightly soluble |
| Logp: | -1.475 |
| Cas_registry_number: | 672-87-7 |
| Drug_category: | Enzyme Inhibitors |
| Indication: | For use in the treatment of patients with pheochromocytoma for preoperative preparation of patients for surgery, management of patients when surgery is contraindicated, and chronic treatment of patients with malignant pheochromocytoma. |
| Pharmacology: | In patients with pheochromocytoma, who produce excessive amounts of norepinephrine and epinephrine, administration of one to four grams of metyrosine per day has reduced catecholamine biosynthesis from about 35 to 80 percent as measured by the total excretion of catecholamines and their metabolites (metanephrine and vanillylmandelic acid). The maximum biochemical effect usually occurs within two to three days, and the urinary concentration of catecholamines and their metabolites usually returns to pretreatment levels within three to four days after metyrosine is discontinued. Most patients with pheochromocytoma treated with metyrosine experience decreased frequency and severity of hypertensive attacks with their associated headache, nausea, sweating, and tachycardia. In patients who respond, blood pressure decreases progressively during the first two days of therapy with metyrosine; after withdrawal, blood pressure usually increases gradually to pretreatment values within two to three days. |
| Mechanism_of_action: | Metyrosine inhibits tyrosine hydroxylase, which catalyzes the first transformation in catecholamine biosynthesis, i.e., the conversion of tyrosine to dihydroxyphenylalanine (DOPA). Because the first step is also the rate-limiting step, blockade of tyrosine hydroxylase activity results in decreased endogenous levels of catecholamines, usually measured as decreased urinary excretion of catecholamines and their metabolites, resulting in reduced blood pressure. |
| Organisms_affected: | Humans and other mammals |
| Found: 24 nonactive as graph: single | with analogs | 1 2 3 4 5 6 7 8 9 10 Next >> [24] |
| Species: | 4932 |
| Condition: | BY4741 |
| Replicates: | 8 |
| Raw OD Value: r im | 0.7559±0.119021 |
| Normalized OD Score: sc h | 0.9729±0.0148694 |
| Z-Score: | -0.8756±0.575422 |
| p-Value: | 0.381262 |
| Z-Factor: | -28.1404 |
| Fitness Defect: | 0.9643 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 54 | << Back 1 2 3 4 5 6 7 8 9 Next >> |
| 5460811 | [(1R)-1-carboxy-2-(4-hydroxyphenyl)ethyl]azanium |
| 5460812 | (2R)-2-amino-3-(4-oxidophenyl)propanoate |
| 5460814 | (2R)-2-amino-3-(4-hydroxyphenyl)propanoate |
| 5460817 | n/a |
| 5460818 | n/a |
| 5460819 | [(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]azanium |
| internal high similarity DBLink | Rows returned: 1 |
| LOPAC 00585 | 1.0000 |
| active | Cluster 367 | Additional Members: 6 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory