Compound Information | SONAR Target prediction | Name: | Pregnenolone sulfate sodium | Unique Identifier: | LOPAC 00530 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C21H31NaO5S | Molecular Weight: | 387.277 g/mol | X log p: | 0.448 (online calculus) | Lipinksi Failures | 0 | TPSA | 91.88 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 3 | Canonical Smiles: | [Na+].[O-]S(=O)(=O)OC1CCC2(C)C3CCC4(C)C(CCC4C(C)=O)C3CC=C2C1 | Class: | GABA | Action: | Antagonist | Selectivity: | GABA-A |
Species: |
4932 |
Condition: |
SAP30 |
Replicates: |
2 |
Raw OD Value: r im |
0.7944±0.0108187 |
Normalized OD Score: sc h |
0.9779±0.00250605 |
Z-Score: |
-1.8980±0.0943617 |
p-Value: |
0.0582572 |
Z-Factor: |
-2.78673 |
Fitness Defect: |
2.8429 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 13|A9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.20 Celcius | Date: | 2005-11-18 YYYY-MM-DD | Plate CH Control (+): | 0.039150000000000004±0.00126 | Plate DMSO Control (-): | 0.7788250000000001±0.01996 | Plate Z-Factor: | 0.9342 |
| png ps pdf |
4902 |
17-acetyl-10,13-dimethyl-3-sulfonatooxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenan threne |
4903 |
17-acetyl-10,13-dimethyl-3-sulfooxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthre ne |
5244 |
10,13-dimethyl-17-oxo-3-sulfooxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene |
12594 |
(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-3-sulfooxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopen ta[a]phenanthrene |
14193 |
sodium (3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-3-sulfonatooxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocycl openta[a]phenanthrene |
83891 |
(8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-3-sulfooxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[ a]phenanthrene |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 7902 | Additional Members: 9 | Rows returned: 4 | |
|