| Compound Information | SONAR Target prediction | | Name: | Methiothepin mesylate | | Unique Identifier: | LOPAC 00521 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C21H28N2O3S3 | | Molecular Weight: | 424.434 g/mol | | X log p: | 15.562 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 57.08 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CSc1ccc2Sc3ccccc3CC(N3CCN(C)CC3)c2c1.CS(O)(=O)=O | | Class: | Serotonin | | Action: | Antagonist | | Selectivity: | 5-HT1E, 5-HT1F, 5-HT6 |
| Species: |
4932 |
| Condition: |
NUM1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6824±0.00848528 |
| Normalized OD Score: sc h |
0.8922±0.00639957 |
| Z-Score: |
-6.6045±0.241608 |
| p-Value: |
0.000000000068514 |
| Z-Factor: |
0.441948 |
| Fitness Defect: |
23.404 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 11|A5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.90 Celcius | | Date: | 2005-11-30 YYYY-MM-DD | | Plate CH Control (+): | 0.038575±0.00085 | | Plate DMSO Control (-): | 0.7434000000000001±0.01050 | | Plate Z-Factor: | 0.9573 |
|  png
ps
pdf |
| DBLink | Rows returned: 3 | |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 5447 | Additional Members: 4 | Rows returned: 2 | |
|
