Compound Information | SONAR Target prediction | Name: | Methiothepin mesylate | Unique Identifier: | LOPAC 00521 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C21H28N2O3S3 | Molecular Weight: | 424.434 g/mol | X log p: | 15.562 (online calculus) | Lipinksi Failures | 1 | TPSA | 57.08 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 2 | Canonical Smiles: | CSc1ccc2Sc3ccccc3CC(N3CCN(C)CC3)c2c1.CS(O)(=O)=O | Class: | Serotonin | Action: | Antagonist | Selectivity: | 5-HT1E, 5-HT1F, 5-HT6 |
Species: |
4932 |
Condition: |
tep1-2nd |
Replicates: |
2 |
Raw OD Value: r im |
0.8153±0.00339411 |
Normalized OD Score: sc h |
1.0221±0.012359 |
Z-Score: |
0.8360±0.459227 |
p-Value: |
0.427444 |
Z-Factor: |
-4.12959 |
Fitness Defect: |
0.8499 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 11|A5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-07-07 YYYY-MM-DD | Plate CH Control (+): | 0.043375±0.00234 | Plate DMSO Control (-): | 0.74515±0.02419 | Plate Z-Factor: | 0.9037 |
| png ps pdf |
DBLink | Rows returned: 3 | |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 5447 | Additional Members: 4 | Rows returned: 2 | |
|