Compound Information | SONAR Target prediction | Name: | U-73122 | Unique Identifier: | LOPAC 00476 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C29H40N2O3 | Molecular Weight: | 424.322 g/mol | X log p: | 10.846 (online calculus) | Lipinksi Failures | 1 | TPSA | 46.61 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 9 | Canonical Smiles: | COc1ccc2C3CCC4(C)C(CCC4C3CCc2c1)NCCCCCCn1c(=O)ccc1=O | Class: | Lipid | Action: | Inhibitor | Selectivity: | PLC, A2 |
Species: |
4932 |
Condition: |
ESC2 |
Replicates: |
2 |
Raw OD Value: r im |
0.5384±0.0390323 |
Normalized OD Score: sc h |
0.9875±0.0188502 |
Z-Score: |
-0.4066±0.611079 |
p-Value: |
0.690644 |
Z-Factor: |
-9.88782 |
Fitness Defect: |
0.3701 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 16|D6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 28.30 Celcius | Date: | 2005-11-25 YYYY-MM-DD | Plate CH Control (+): | 0.039349999999999996±0.00645 | Plate DMSO Control (-): | 0.538125±0.01646 | Plate Z-Factor: | 0.9142 |
| png ps pdf |
DBLink | Rows returned: 0 | |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 3283 | Additional Members: 12 | Rows returned: 7 | 1 2 Next >> |
|