| Compound Information | SONAR Target prediction | | Name: | U-73122 | | Unique Identifier: | LOPAC 00476 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C29H40N2O3 | | Molecular Weight: | 424.322 g/mol | | X log p: | 10.846 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 46.61 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 9 | | Canonical Smiles: | COc1ccc2C3CCC4(C)C(CCC4C3CCc2c1)NCCCCCCn1c(=O)ccc1=O | | Class: | Lipid | | Action: | Inhibitor | | Selectivity: | PLC, A2 |
| Species: |
4932 |
| Condition: |
CLN3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.3124±0.387353 |
| Normalized OD Score: sc h |
0.4436±0.550046 |
| Z-Score: |
-17.8030±15.9794 |
| p-Value: |
0.0000000000391428 |
| Z-Factor: |
-2.7813 |
| Fitness Defect: |
23.9638 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 16|D6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.90 Celcius | | Date: | 2005-05-08 YYYY-MM-DD | | Plate CH Control (+): | 0.050574999999999995±0.00185 | | Plate DMSO Control (-): | 0.6905749999999999±0.07499 | | Plate Z-Factor: | 0.8044 |
|  png
ps
pdf |
| DBLink | Rows returned: 0 | |
| internal high similarity DBLink | Rows returned: 0 | |
|
