| Compound Information | SONAR Target prediction | | Name: | Citicoline sodium | | Unique Identifier: | LOPAC 00475 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C13H23N4NaO11P2 | | Molecular Weight: | 473.097 g/mol | | X log p: | 0.115 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 169.47 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 15 | | Rotatable Bond Count: | 9 | | Canonical Smiles: | [Na+].[O-]P(=O)(OCC1OC(C(O)C1O)N1C=CC(N)=NC1=O)OP([O-])(=O)OCN(C)(C)C | | Class: | Lipid | | Action: | Inhibitor | | Selectivity: | PLA2 |
| Species: |
4932 |
| Condition: |
NOP13 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7658±0.104086 |
| Normalized OD Score: sc h |
0.9914±0.020149 |
| Z-Score: |
-0.4763±1.01053 |
| p-Value: |
0.522702 |
| Z-Factor: |
-4.34895 |
| Fitness Defect: |
0.6487 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 3|H8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-04-22 YYYY-MM-DD | | Plate CH Control (+): | 0.0507±0.00318 | | Plate DMSO Control (-): | 0.729825±0.26961 | | Plate Z-Factor: | -0.5169 |
| png ps pdf |
| DBLink | Rows returned: 2 | |
| 6604068 |
sodium [[[(2S,3S,4S,5R)-5-(4-amino-2-oxo-pyrimidin-1-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-oxido-phosphoryl]oxy -oxido-phosphoryl]oxymethyl-trimethyl-azanium |
| 6604069 |
[[[(2S,3S,4S,5R)-5-(4-amino-2-oxo-pyrimidin-1-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-hydroxy-phosphoryl]o xy-hydroxy-phosphoryl]oxymethyl-trimethyl-azanium |
| internal high similarity DBLink | Rows returned: 1 | |
| nonactive | Cluster 7710 | Additional Members: 3 | Rows returned: 2 | |
|