Compound Information | SONAR Target prediction | Name: | Resveratrol | Unique Identifier: | LOPAC 00461 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C14H12O3 | Molecular Weight: | 216.148 g/mol | X log p: | 19.059 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | Oc1ccc(cc1)C=Cc1cc(O)cc(O)c1 | Class: | Prostaglandin | Action: | Inhibitor | Selectivity: | COX | Generic_name: | RESVERATROL | Chemical_iupac_name: | RESVERATROL | Drug_type: | Experimental | Kegg_compound_id: | C03582 | Drugbank_id: | EXPT02968 | Logp: | 3.316 | Cas_registry_number: | 501-36-0 | Drug_category: | Nrh Dehydrogenase [Quinone] 2 inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
SQS1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7020±0.00346482 |
Normalized OD Score: sc h |
0.9741±0.0192057 |
Z-Score: |
-1.1882±0.669849 |
p-Value: |
0.285706 |
Z-Factor: |
-24.9055 |
Fitness Defect: |
1.2528 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 14|H2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-05-21 YYYY-MM-DD | Plate CH Control (+): | 0.048475000000000004±0.00139 | Plate DMSO Control (-): | 0.72455±0.02773 | Plate Z-Factor: | 0.8559 |
| png ps pdf |
DBLink | Rows returned: 3 | |
5056 |
5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
445154 |
5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
1548910 |
5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
internal high similarity DBLink | Rows returned: 3 | |
nonactive | Cluster 1910 | Additional Members: 8 | Rows returned: 5 | |
|