| Compound Information | SONAR Target prediction | | Name: | Resveratrol | | Unique Identifier: | LOPAC 00461 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C14H12O3 | | Molecular Weight: | 216.148 g/mol | | X log p: | 19.059 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | Oc1ccc(cc1)C=Cc1cc(O)cc(O)c1 | | Class: | Prostaglandin | | Action: | Inhibitor | | Selectivity: | COX | | Generic_name: | RESVERATROL | | Chemical_iupac_name: | RESVERATROL | | Drug_type: | Experimental | | Kegg_compound_id: | C03582 | | Drugbank_id: | EXPT02968 | | Logp: | 3.316 | | Cas_registry_number: | 501-36-0 | | Drug_category: | Nrh Dehydrogenase [Quinone] 2 inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
LGE1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4754±0.0119501 |
| Normalized OD Score: sc h |
1.0420±0.00956018 |
| Z-Score: |
1.4380±0.285948 |
| p-Value: |
0.158755 |
| Z-Factor: |
-2.76541 |
| Fitness Defect: |
1.8404 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 14|H2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.80 Celcius | | Date: | 2005-11-29 YYYY-MM-DD | | Plate CH Control (+): | 0.039325±0.00063 | | Plate DMSO Control (-): | 0.447325±0.02185 | | Plate Z-Factor: | 0.8046 |
|  png
ps
pdf |
| DBLink | Rows returned: 3 | |
| 5056 |
5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| 445154 |
5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| 1548910 |
5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 1910 | Additional Members: 8 | Rows returned: 5 | |
|
