| Compound Information | SONAR Target prediction | | Name: | Genistein | | Unique Identifier: | LOPAC 00433 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H10O5 | | Molecular Weight: | 260.158 g/mol | | X log p: | 14.737 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1ccc(cc1)C1=COc2cc(O)cc(O)c2C1=O | | Class: | Phosphorylation | | Action: | Inhibitor | | Selectivity: | Tyrosine kinase | | Generic_name: | 5,7-DIHYDROXY-3-(4-HYDROXYPHENYL)-4H-1-B | | Chemical_iupac_name: | GENISTEIN | | Drug_type: | Experimental | | Kegg_compound_id: | C06563 | | Drugbank_id: | EXPT01582 | | Logp: | 1.89 | | Cas_registry_number: | 446-72-0 | | Drug_category: | Estrogen Receptor Beta inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
TEP1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5866±0.0279307 |
| Normalized OD Score: sc h |
1.0144±0.000148334 |
| Z-Score: |
0.5768±0.100162 |
| p-Value: |
0.56506 |
| Z-Factor: |
-4.6598 |
| Fitness Defect: |
0.5708 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 7|D11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-05-17 YYYY-MM-DD | | Plate CH Control (+): | 0.04404999999999999±0.00509 | | Plate DMSO Control (-): | 0.575175±0.02712 | | Plate Z-Factor: | 0.8882 |
| png ps pdf |
| DBLink | Rows returned: 2 | |
| 5280961 |
5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| 11000304 |
6,8-dideuterio-5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 17 | 1 2 3 Next >> |
| nonactive | Cluster 14679 | Additional Members: 9 | Rows returned: 6 | |
|