| Compound Information | SONAR Target prediction |  | Name: | Ciclosporin |  | Unique Identifier: | LOPAC 00423  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C62H111N11O12 |  | Molecular Weight: | 1090.73 g/mol |  | X log p: |   (online calculus) |  | Lipinksi Failures |  |  | TPSA |  |  | Hydrogen Bond Donor Count: |  |  | Hydrogen Bond Acceptors Count: |  |  | Rotatable Bond Count: |  |  | Canonical Smiles: | CCC1NC(=O)C(C(O)C(C)CC=CC)N(C)C(=O)C(C(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O) C(CC(C)C)N(C)C(=O)C(C)NC(=O)C(C)NC(=O)C(CC(C)C)N(C)C(=O)C(NC(=O)C(CC(C )C)N(C)C(=O)CN(C)C1=O)C(C)C |  | Class: | Phosphorylation |  | Action: | Inhibitor |  | Selectivity: | Calcineurin phosphatase |  | Generic_name: | Cyclosporine |  | Chemical_iupac_name: | Cyclosporine |  | Drug_type: | Approved Drug |  | Pharmgkb_id: | PA449167 |  | Drugbank_id: | BIOD00003 |  | Logp: | 4.293 |  | Cas_registry_number: | 59865-13-3 |  | Drug_category: | Immunmodulatory Agents; Immunosupressants |  | Indication: | For treatment of transplant rejection, rheumatoid arthritis, severe psoriasis |  | Pharmacology: | Used in immunosuppression for prophylactic treatment of organ transplants, cyclosporine exerts specific and reversible inhibition of immunocompetent lymphocytes in the G0-or G1-phase of the cell cycle. T-lymphocytes are preferentially inhibited. The T1-helper cell is the main target, although the T1-suppressor cell may also be suppressed. Sandimmune (cyclosporine) also inhibits lymphokine production and release including interleukin-2. |  | Mechanism_of_action: | Cyclosporine binds to cyclophillin. The complex then inhibits calcineurin which is normally responsible for activating transcription of interleukin 2. Cyclosporine also inhibits lymphokine production and ineterluekin relase. |  | Organisms_affected: | Humans and other mammals |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		GIM3 | 
	 
	
		| Replicates: | 
		4 | 
	 
	
		| Raw OD Value: r im | 
		0.5552±0.0398185 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9908±0.0870464 | 
	 
	
		| Z-Score: | 
		-0.1408±2.18519 | 
	 
	
		| p-Value: | 
		0.574046 | 
	 
	
		| Z-Factor: | 
		-5.53925 | 
	 
	
		| Fitness Defect: | 
		0.555 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Lopac |  | Plate Number and Position: | 4|A3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 27.50 Celcius |  | Date: | 2005-04-08 YYYY-MM-DD |  | Plate CH Control (+): | 0.0456±0.00310 |  | Plate DMSO Control (-): | 0.6872750000000001±0.18870 |  | Plate Z-Factor: | -0.0980 |  
  |  png ps pdf |  
 
 
	
		| 2909 | 
		30-ethyl-33-(1-hydroxy-2-methyl-hex-4-enyl)-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-meth ylpropyl)-3,21-dipropan-2-yl-1,4,7,10,13,16,19,22,25,28,31-undecazacyclotritriacontane-2,5,8,11,14,17,20 ,23,26,29,32-undecone | 
	 
	
		| 171409 | 
		(3S,6S,9S,12R,15S,18S,21S,24S,30S,33S)-30-ethyl-33-[(1R,2R)-1-hydroxy-2-methyl-hex-4-enyl]-1,4,7,10,12,1 5,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-dipropan-2-yl-1,4,7,10,13,16,19,22,25,28,3 1-undecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone | 
	 
	
		| 5280754 | 
		30-ethyl-33-[(E)-1-hydroxy-2-methyl-hex-4-enyl]-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2- methylpropyl)-3,21-dipropan-2-yl-1,4,7,10,13,16,19,22,25,28,31-undecazacyclotritriacontane-2,5,8,11,14,1 7,20,23,26,29,32-undecone | 
	 
	
		| 5284373 | 
		(3S,6S,9S,12R,15S,18S,21S,24S,30S,33S)-30-ethyl-33-[(E,1R,2R)-1-hydroxy-2-methyl-hex-4-enyl]-1,4,7,10,12 ,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-dipropan-2-yl-1,4,7,10,13,16,19,22,25,28 ,31-undecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone | 
	 
	
		| 5287812 | 
		(3S,6S,9S,12R,15S,18S,21S,24S,27R,30S,33S)-30-ethyl-27-(hydroxymethyl)-33-[(E,1R,2R)-1-hydroxy-2-methyl- hex-4-enyl]-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-dipropan-2-yl-1,4 ,7,10,13,16,19,22,25,28,31-undecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone | 
	 
	
		| 5287814 | 
		(3S,6S,9S,12R,15S,18S,21S,24S,30S,33S)-30-ethyl-33-[(E,1R,2R)-1-hydroxy-2-methyl-hex-4-enyl]-1,4,7,10,12 ,15,19,25,28-nonamethyl-24-[(2R)-2-methylbutyl]-6,9,18-tris(2-methylpropyl)-3,21-dipropan-2-yl-1,4,7,10, 13,16,19,22,25,28,31-undecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone | 
	 
 
 | internal high similarity DBLink  | Rows returned: 1 |  |   
 |  active | Cluster 1190 | Additional Members: 4 | Rows returned: 1 |  |   
 
 |