| 
 | Compound Information | SONAR Target prediction |  | Name: | Ciclosporin |  | Unique Identifier: | LOPAC 00423 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C62H111N11O12 |  | Molecular Weight: | 1090.73 g/mol |  | X log p: | (online calculus) |  | Lipinksi Failures |  |  | TPSA |  |  | Hydrogen Bond Donor Count: |  |  | Hydrogen Bond Acceptors Count: |  |  | Rotatable Bond Count: |  |  | Canonical Smiles: | CCC1NC(=O)C(C(O)C(C)CC=CC)N(C)C(=O)C(C(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O) C(CC(C)C)N(C)C(=O)C(C)NC(=O)C(C)NC(=O)C(CC(C)C)N(C)C(=O)C(NC(=O)C(CC(C
 )C)N(C)C(=O)CN(C)C1=O)C(C)C
 |  | Class: | Phosphorylation |  | Action: | Inhibitor |  | Selectivity: | Calcineurin phosphatase |  | Generic_name: | Cyclosporine |  | Chemical_iupac_name: | Cyclosporine |  | Drug_type: | Approved Drug |  | Pharmgkb_id: | PA449167 |  | Drugbank_id: | BIOD00003 |  | Logp: | 4.293 |  | Cas_registry_number: | 59865-13-3 |  | Drug_category: | Immunmodulatory Agents; Immunosupressants |  | Indication: | For treatment of transplant rejection, rheumatoid arthritis, severe psoriasis |  | Pharmacology: | Used in immunosuppression for prophylactic treatment of organ transplants, cyclosporine exerts specific and reversible inhibition of immunocompetent
 lymphocytes in the G0-or G1-phase of the cell cycle. T-lymphocytes are
 preferentially inhibited. The T1-helper cell is the main target, although the
 T1-suppressor cell may also be suppressed. Sandimmune (cyclosporine) also inhibits
 lymphokine production and release including interleukin-2.
 |  | Mechanism_of_action: | Cyclosporine binds to cyclophillin. The complex then inhibits calcineurin which is normally responsible for activating transcription of interleukin 2. Cyclosporine
 also inhibits lymphokine production and ineterluekin relase.
 |  | Organisms_affected: | Humans and other mammals | 
 
 
	
		| Species: | 4932 |  
		| Condition: | KRE1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6928±0.0178898 |  
		| Normalized OD Score: sc h | 1.0020±0.0088968 |  
		| Z-Score: | 0.0900±0.383063 |  
		| p-Value: | 0.787334 |  
		| Z-Factor: | -9.30471 |  
		| Fitness Defect: | 0.2391 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Lopac |  | Plate Number and Position: | 4|A3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 27.80 Celcius |  | Date: | 2005-11-22 YYYY-MM-DD |  | Plate CH Control (+): | 0.039775000000000005±0.00261 |  | Plate DMSO Control (-): | 0.6763250000000001±0.02277 |  | Plate Z-Factor: | 0.9484 | 
 |  png ps
 pdf
 | 
 
 
	
		| 2909 | 30-ethyl-33-(1-hydroxy-2-methyl-hex-4-enyl)-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-meth ylpropyl)-3,21-dipropan-2-yl-1,4,7,10,13,16,19,22,25,28,31-undecazacyclotritriacontane-2,5,8,11,14,17,20
 ,23,26,29,32-undecone
 |  
		| 171409 | (3S,6S,9S,12R,15S,18S,21S,24S,30S,33S)-30-ethyl-33-[(1R,2R)-1-hydroxy-2-methyl-hex-4-enyl]-1,4,7,10,12,1 5,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-dipropan-2-yl-1,4,7,10,13,16,19,22,25,28,3
 1-undecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone
 |  
		| 5280754 | 30-ethyl-33-[(E)-1-hydroxy-2-methyl-hex-4-enyl]-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2- methylpropyl)-3,21-dipropan-2-yl-1,4,7,10,13,16,19,22,25,28,31-undecazacyclotritriacontane-2,5,8,11,14,1
 7,20,23,26,29,32-undecone
 |  
		| 5284373 | (3S,6S,9S,12R,15S,18S,21S,24S,30S,33S)-30-ethyl-33-[(E,1R,2R)-1-hydroxy-2-methyl-hex-4-enyl]-1,4,7,10,12 ,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-dipropan-2-yl-1,4,7,10,13,16,19,22,25,28
 ,31-undecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone
 |  
		| 5287812 | (3S,6S,9S,12R,15S,18S,21S,24S,27R,30S,33S)-30-ethyl-27-(hydroxymethyl)-33-[(E,1R,2R)-1-hydroxy-2-methyl- hex-4-enyl]-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-dipropan-2-yl-1,4
 ,7,10,13,16,19,22,25,28,31-undecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone
 |  
		| 5287814 | (3S,6S,9S,12R,15S,18S,21S,24S,30S,33S)-30-ethyl-33-[(E,1R,2R)-1-hydroxy-2-methyl-hex-4-enyl]-1,4,7,10,12 ,15,19,25,28-nonamethyl-24-[(2R)-2-methylbutyl]-6,9,18-tris(2-methylpropyl)-3,21-dipropan-2-yl-1,4,7,10,
 13,16,19,22,25,28,31-undecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone
 |  
 | internal high similarity DBLink  | Rows returned: 1 |  | 
 
 | active | Cluster 1190 | Additional Members: 4 | Rows returned: 1 |  | 
 
 |