| Compound Information | SONAR Target prediction | | Name: | Ciclosporin | | Unique Identifier: | LOPAC 00423 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C62H111N11O12 | | Molecular Weight: | 1090.73 g/mol | | X log p: | (online calculus) | | Lipinksi Failures | | | TPSA | | | Hydrogen Bond Donor Count: | | | Hydrogen Bond Acceptors Count: | | | Rotatable Bond Count: | | | Canonical Smiles: | CCC1NC(=O)C(C(O)C(C)CC=CC)N(C)C(=O)C(C(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O) C(CC(C)C)N(C)C(=O)C(C)NC(=O)C(C)NC(=O)C(CC(C)C)N(C)C(=O)C(NC(=O)C(CC(C )C)N(C)C(=O)CN(C)C1=O)C(C)C | | Class: | Phosphorylation | | Action: | Inhibitor | | Selectivity: | Calcineurin phosphatase | | Generic_name: | Cyclosporine | | Chemical_iupac_name: | Cyclosporine | | Drug_type: | Approved Drug | | Pharmgkb_id: | PA449167 | | Drugbank_id: | BIOD00003 | | Logp: | 4.293 | | Cas_registry_number: | 59865-13-3 | | Drug_category: | Immunmodulatory Agents; Immunosupressants | | Indication: | For treatment of transplant rejection, rheumatoid arthritis, severe psoriasis | | Pharmacology: | Used in immunosuppression for prophylactic treatment of organ transplants, cyclosporine exerts specific and reversible inhibition of immunocompetent lymphocytes in the G0-or G1-phase of the cell cycle. T-lymphocytes are preferentially inhibited. The T1-helper cell is the main target, although the T1-suppressor cell may also be suppressed. Sandimmune (cyclosporine) also inhibits lymphokine production and release including interleukin-2. | | Mechanism_of_action: | Cyclosporine binds to cyclophillin. The complex then inhibits calcineurin which is normally responsible for activating transcription of interleukin 2. Cyclosporine also inhibits lymphokine production and ineterluekin relase. | | Organisms_affected: | Humans and other mammals |
| Species: |
4932 |
| Condition: |
CLN3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7106±0.0147078 |
| Normalized OD Score: sc h |
1.0416±0.00176408 |
| Z-Score: |
1.4437±0.175534 |
| p-Value: |
0.151951 |
| Z-Factor: |
-2.10718 |
| Fitness Defect: |
1.8842 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 4|A3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.80 Celcius | | Date: | 2005-05-08 YYYY-MM-DD | | Plate CH Control (+): | 0.04785±0.00081 | | Plate DMSO Control (-): | 0.6973±0.04791 | | Plate Z-Factor: | 0.6869 |
| png ps pdf |
| 6476563 |
(3S,6S,9S,12R,15S,18S,21S,24S,30S,33S)-30-ethyl-33-[(E,1R,2R)-1-hydroxy-2-methyl-hex-4-enyl]-1,4,7,10,12 ,15,19,25,28-nonamethyl-3,6,9,18,24-pentakis(2-methylpropyl)-21-propan-2-yl-1,4,7,10,13,16,19,22,25,28,3 1-undecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone |
| 6476564 |
(3R,6S,9S,12R,15S,18S,21S,24S,30S,33S)-30-ethyl-33-[(E,1R,2R)-1-hydroxy-2-methyl-hex-4-enyl]-1,4,7,10,12 ,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-dipropan-2-yl-1,4,7,10,13,16,19,22,25,28 ,31-undecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone |
| 6603775 |
(3S,6S,9S,12S,15S,18S,21S,24S,30S,33S)-30-ethyl-33-[(E,1S,2S)-1-hydroxy-2-methyl-hex-4-enyl]-1,4,7,10,12 ,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-dipropan-2-yl-1,4,7,10,13,16,19,22,25,28 ,31-undecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone |
| 6604816 |
(3S,6S,9S,12R,15S,18S,21S,24S,30S,33S)-30-ethyl-33-[(E,1R,2R)-1-hydroxy-2-methyl-hex-4-enyl]-1,4,7,10,12 ,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-dipropan-2-yl-1,4,7,10,13,16,19,22,25,28 ,31-undecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone |
| 6610296 |
(12R)-30-ethyl-33-[(1R,2R)-1-hydroxy-2-methyl-hex-4-enyl]-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24-t etrakis(2-methylpropyl)-3,21-dipropan-2-yl-1,4,7,10,13,16,19,22,25,28,31-undecazacyclotritriacontane-2,5 ,8,11,14,17,20,23,26,29,32-undecone |
| 6711153 |
(6S,9S,12R,15S,18S,21S,24S,30S,33S)-30-ethyl-33-[(1R,2R)-1-hydroxy-2-methyl-hex-4-enyl]-1,4,7,10,12,15,1 9,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-dipropan-2-yl-1,4,7,10,13,16,19,22,25,28,31-u ndecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 1190 | Additional Members: 4 | Rows returned: 1 | |
|