| Compound Information | SONAR Target prediction | | Name: | 8-(4-Chlorophenylthio)-cAMP sodium | | Unique Identifier: | LOPAC 00419 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C16ClH14N5NaO6PS | | Molecular Weight: | 479.684 g/mol | | X log p: | 8.861 (online calculus) | | Lipinksi Failures | 2 | | TPSA | 143.25 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 11 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | [Na+].[O-]P1(=O)OCC2OC(C(O)C2O1)n1c(Sc2ccc(Cl)cc2)nc2c(N)ncnc12 | | Class: | Cyclic Nucleotides | | Action: | Activator |
| Species: |
4932 |
| Condition: |
HOC1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6108±0.0395273 |
| Normalized OD Score: sc h |
0.9971±0.00939292 |
| Z-Score: |
-0.1158±0.420803 |
| p-Value: |
0.767562 |
| Z-Factor: |
-1401.31 |
| Fitness Defect: |
0.2645 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 4|C3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.50 Celcius | | Date: | 2005-11-24 YYYY-MM-DD | | Plate CH Control (+): | 0.039825±0.00153 | | Plate DMSO Control (-): | 0.59845±0.01770 | | Plate Z-Factor: | 0.9359 |
| png ps pdf |
| DBLink | Rows returned: 6 | |
| 1903 |
8-[6-amino-8-(4-chlorophenyl)sulfanyl-purin-9-yl]-3-oxido-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3. 0]nonan-9-ol |
| 1904 |
8-[6-amino-8-(4-chlorophenyl)sulfanyl-purin-9-yl]-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4. 3.0]nonan-9-ol |
| 1905 |
sodium 8-[6-amino-8-(4-chlorophenyl)sulfanyl-purin-9-yl]-3-oxido-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3. 0]nonan-9-ol |
| 91636 |
(1R,6R,8R,9R)-8-[6-amino-8-(4-chlorophenyl)sulfanyl-purin-9-yl]-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-pho sphabicyclo[4.3.0]nonan-9-ol |
| 6604074 |
sodium (1S,6S,8R,9R)-8-[6-amino-8-(4-chlorophenyl)sulfanyl-purin-9-yl]-3-oxido-3-oxo-2,4,7-trioxa-3$l^{5}-phosp habicyclo[4.3.0]nonan-9-ol |
| 6604075 |
(1S,6S,8R,9R)-8-[6-amino-8-(4-chlorophenyl)sulfanyl-purin-9-yl]-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-pho sphabicyclo[4.3.0]nonan-9-ol |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 1044 | Additional Members: 3 | Rows returned: 2 | |
|