Compound Information | SONAR Target prediction | Name: | 8-(4-Chlorophenylthio)-cAMP sodium | Unique Identifier: | LOPAC 00419 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C16ClH14N5NaO6PS | Molecular Weight: | 479.684 g/mol | X log p: | 8.861 (online calculus) | Lipinksi Failures | 2 | TPSA | 143.25 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 11 | Rotatable Bond Count: | 3 | Canonical Smiles: | [Na+].[O-]P1(=O)OCC2OC(C(O)C2O1)n1c(Sc2ccc(Cl)cc2)nc2c(N)ncnc12 | Class: | Cyclic Nucleotides | Action: | Activator |
Species: |
4932 |
Condition: |
TEP1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6122±0.0165463 |
Normalized OD Score: sc h |
1.0258±0.00393466 |
Z-Score: |
1.0197±0.0113601 |
p-Value: |
0.307878 |
Z-Factor: |
-3.73852 |
Fitness Defect: |
1.1781 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 4|C3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-05-17 YYYY-MM-DD | Plate CH Control (+): | 0.044950000000000004±0.00877 | Plate DMSO Control (-): | 0.5674250000000001±0.04389 | Plate Z-Factor: | 0.7544 |
| png ps pdf |
DBLink | Rows returned: 6 | |
1903 |
8-[6-amino-8-(4-chlorophenyl)sulfanyl-purin-9-yl]-3-oxido-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3. 0]nonan-9-ol |
1904 |
8-[6-amino-8-(4-chlorophenyl)sulfanyl-purin-9-yl]-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4. 3.0]nonan-9-ol |
1905 |
sodium 8-[6-amino-8-(4-chlorophenyl)sulfanyl-purin-9-yl]-3-oxido-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3. 0]nonan-9-ol |
91636 |
(1R,6R,8R,9R)-8-[6-amino-8-(4-chlorophenyl)sulfanyl-purin-9-yl]-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-pho sphabicyclo[4.3.0]nonan-9-ol |
6604074 |
sodium (1S,6S,8R,9R)-8-[6-amino-8-(4-chlorophenyl)sulfanyl-purin-9-yl]-3-oxido-3-oxo-2,4,7-trioxa-3$l^{5}-phosp habicyclo[4.3.0]nonan-9-ol |
6604075 |
(1S,6S,8R,9R)-8-[6-amino-8-(4-chlorophenyl)sulfanyl-purin-9-yl]-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-pho sphabicyclo[4.3.0]nonan-9-ol |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 1044 | Additional Members: 3 | Rows returned: 2 | |
|