| Compound Information | SONAR Target prediction | | Name: | 8-Bromo-cAMP sodium | | Unique Identifier: | LOPAC 00415 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | BrC10H10N5NaO6P | | Molecular Weight: | 420.005 g/mol | | X log p: | 0.39 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 117.95 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 11 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | [Na+].[O-]P1(=O)OCC2OC(C(O)C2O1)n1c(Br)nc2c(N)ncnc12 | | Class: | Cyclic Nucleotides | | Action: | Activator |
| Species: |
4932 |
| Condition: |
GAS1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6811±0.025173 |
| Normalized OD Score: sc h |
1.0002±0.0194409 |
| Z-Score: |
0.0106±0.932303 |
| p-Value: |
0.509766 |
| Z-Factor: |
-99.7975 |
| Fitness Defect: |
0.6738 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 3|C5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.30 Celcius | | Date: | 2005-11-17 YYYY-MM-DD | | Plate CH Control (+): | 0.03925±0.00128 | | Plate DMSO Control (-): | 0.680275±0.01304 | | Plate Z-Factor: | 0.9499 |
| png ps pdf |
| 6604826 |
(1R,6S,8S,9S)-8-(6-amino-8-bromo-purin-9-yl)-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]n onan-9-ol |
| 6610262 |
(1S,6S,8S,9S)-8-(6-amino-8-bromo-purin-9-yl)-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]n onan-9-ol |
| 6610315 |
(1S,6S,9S)-8-(6-amino-8-bromo-purin-9-yl)-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]nona n-9-ol |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 1044 | Additional Members: 3 | Rows returned: 0 | |
|