| Compound Information | SONAR Target prediction |
| Name: | S-Methyl-L-thiocitrulline acetate |
| Unique Identifier: | LOPAC 00411 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C9H19N3O4S |
| Molecular Weight: | 246.18 g/mol |
| X log p: | -1.762 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 42.37 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 7 |
| Canonical Smiles: | CSC(=N)NCCCC(N)C(O)=O.CC(O)=O |
| Class: | Nitric Oxide |
| Action: | Inhibitor |
| Selectivity: | NOS |
| Found: 24 nonactive as graph: single | with analogs | [1] << Back 1 2 3 4 5 6 7 8 9 10 Next >> [24] |
| Species: | 4932 |
| Condition: | GIM3 |
| Replicates: | 4 |
| Raw OD Value: r im | 0.5178±0.0615963 |
| Normalized OD Score: sc h | 1.0185±0.0245043 |
| Z-Score: | 0.3582±0.607185 |
| p-Value: | 0.721896 |
| Z-Factor: | -3.79355 |
| Fitness Defect: | 0.3259 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 4071 | Additional Members: 12 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory