| Compound Information | SONAR Target prediction | | Name: | Rp-cAMPS triethylamine | | Unique Identifier: | LOPAC 00406 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C16H27N6O5PS | | Molecular Weight: | 419.248 g/mol | | X log p: | 3.605 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 132.97 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 10 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | [O-]P1(=S)OCC2OC(C(O)C2O1)n1cnc2c(N)ncnc12.CC[NH+](CC)CC | | Class: | Phosphorylation | | Action: | Inhibitor | | Selectivity: | PKA |
| Species: |
4932 |
| Condition: |
tep1-2nd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7197±0.158745 |
| Normalized OD Score: sc h |
1.0173±0.00089725 |
| Z-Score: |
0.6554±0.041628 |
| p-Value: |
0.512416 |
| Z-Factor: |
-2.67239 |
| Fitness Defect: |
0.6686 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 2|F8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-07-07 YYYY-MM-DD | | Plate CH Control (+): | 0.04385±0.00194 | | Plate DMSO Control (-): | 0.66165±0.02240 | | Plate Z-Factor: | 0.9361 |
|  png
ps
pdf |
| DBLink | Rows returned: 0 | |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 725 | Additional Members: 3 | Rows returned: 0 | |
|
