| Compound Information | SONAR Target prediction |
| Name: | Trifluoperazine dihydrochloride |
| Unique Identifier: | LOPAC 00319 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C21Cl2F3H26N3S |
| Molecular Weight: | 454.212 g/mol |
| X log p: | 17.027 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 35.02 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 3 |
| Rotatable Bond Count: | 5 |
| Canonical Smiles: | Cl.Cl.CN1CCN(CCCN2c3ccccc3Sc3ccc(cc23)C(F)(F)F)CC1 |
| Class: | Dopamine |
| Action: | Antagonist |
| Selectivity: | D1/D2 |
| Generic_name: | Trifluoperazine |
| Chemical_iupac_name: | 10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)-10H-phenothiazine |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA451771 |
| Kegg_compound_id: | C07168 |
| Drugbank_id: | APRD00173 |
| Logp: | 5.366 |
| Cas_registry_number: | 117-89-5 |
| Mass_spectrum: | http://webbook.nist.gov/cgi/cbook.cgi?Spec=C117895&Index=0&Type=Mass&Large=on |
| Drug_category: | Antipsychotics; Antiemetics; Phenothiazines; ATC:N05AB06 |
| Indication: | For the treatment of anxiety disorders, depressive symptoms secondary to anxiety and agitation. |
| Pharmacology: | Trifluoperazine is a trifluoro-methyl phenothiazine derivative intended for the management of schizophrenia and other psychotic disorders. Trifluoperazine has not been shown effective in the management of behaviorial complications in patients with mental retardation. |
| Mechanism_of_action: | Trifluoperazine blocks postsynaptic mesolimbic dopaminergic D1 and D2 receptors in the brain; depresses the release of hypothalamic and hypophyseal hormones and is believed to depress the reticular activating system thus affecting basal metabolism, body temperature, wakefulness, vasomotor tone, and emesis. |
| Organisms_affected: | Humans and other mammals |
| 370853 |
10-(3-piperazin-1-ylpropyl)-2-(trifluoromethyl)phenothiazine |
| 413626 |
10-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine |
| 657206 |
hydrogen(+1) cation; 10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine; chloride |
| 1399063 |
10-[3-(2,3,5,6-tetrahydropyrazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine |
| 2913535 |
10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine hydrochloride |
| 3859612 |
10-[3-(4-methyl-2,3,5,6-tetrahydropyrazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine |