| Compound Information | SONAR Target prediction |  | Name: | Trifluperidol hydrochloride |  | Unique Identifier: | LOPAC 00317  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C22ClF4H24NO2 |  | Molecular Weight: | 421.687 g/mol |  | X log p: | 16.535  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 20.31 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | Cl.OC1(CCN(CCCC(=O)c2ccc(F)cc2)CC1)c1cccc(c1)C(F)(F)F |  | Class: | Dopamine |  | Action: | Antagonist |  | Selectivity: | D1/D2 |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		LGE1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.3857±0.0337997 | 
	 
	
		| Normalized OD Score: sc h | 
		0.7962±0.0330598 | 
	 
	
		| Z-Score: | 
		-6.9771±0.930205 | 
	 
	
		| p-Value: | 
		0.000000000131315 | 
	 
	
		| Z-Factor: | 
		0.280695 | 
	 
	
		| Fitness Defect: | 
		22.7534 | 
	 
	
		| Bioactivity Statement: | 
		Active | 
	 
 
| Experimental Conditions |  |  | Library: | Lopac |  | Plate Number and Position: | 16|E4 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.90 Celcius |  | Date: | 2005-11-29 YYYY-MM-DD |  | Plate CH Control (+): | 0.038825±0.00101 |  | Plate DMSO Control (-): | 0.46795±0.00740 |  | Plate Z-Factor: | 0.9388 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 2 |  |  
 
	
		| 5567 | 
		1-(4-fluorophenyl)-4-[4-hydroxy-4-[3-(trifluoromethyl)phenyl]-1-piperidyl]butan-1-one | 
	 
	
		| 16361 | 
		1-(4-fluorophenyl)-4-[4-hydroxy-4-[3-(trifluoromethyl)phenyl]-2,3,5,6-tetrahydropyridin-1-yl]butan-1-one chloride | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
  
 
 |