Compound Information | SONAR Target prediction | Name: | Trifluperidol hydrochloride | Unique Identifier: | LOPAC 00317 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C22ClF4H24NO2 | Molecular Weight: | 421.687 g/mol | X log p: | 16.535 (online calculus) | Lipinksi Failures | 1 | TPSA | 20.31 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 7 | Canonical Smiles: | Cl.OC1(CCN(CCCC(=O)c2ccc(F)cc2)CC1)c1cccc(c1)C(F)(F)F | Class: | Dopamine | Action: | Antagonist | Selectivity: | D1/D2 |
Species: |
4932 |
Condition: |
CIN2 |
Replicates: |
2 |
Raw OD Value: r im |
0.8004±0.0157685 |
Normalized OD Score: sc h |
0.9677±0.00967292 |
Z-Score: |
-2.4265±0.493611 |
p-Value: |
0.0216364 |
Z-Factor: |
-1.30411 |
Fitness Defect: |
3.8334 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 16|E4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.00 Celcius | Date: | 2005-12-07 YYYY-MM-DD | Plate CH Control (+): | 0.038625±0.17328 | Plate DMSO Control (-): | 0.810975±0.01237 | Plate Z-Factor: | 0.9630 |
| png ps pdf |
DBLink | Rows returned: 2 | |
5567 |
1-(4-fluorophenyl)-4-[4-hydroxy-4-[3-(trifluoromethyl)phenyl]-1-piperidyl]butan-1-one |
16361 |
1-(4-fluorophenyl)-4-[4-hydroxy-4-[3-(trifluoromethyl)phenyl]-2,3,5,6-tetrahydropyridin-1-yl]butan-1-one chloride |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 16161 | Additional Members: 10 | Rows returned: 4 | |
|