| Compound Information | SONAR Target prediction | | Name: | Indatraline hydrochloride | | Unique Identifier: | LOPAC 00315 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C16Cl3H16N | | Molecular Weight: | 312.536 g/mol | | X log p: | 16.073 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | Cl.CNC1CC(c2ccc(Cl)c(Cl)c2)c2ccccc12 | | Class: | Dopamine | | Action: | Inhibitor | | Selectivity: | Reuptake |
| Species: |
4932 |
| Condition: |
LGE1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4318±0.0192333 |
| Normalized OD Score: sc h |
0.9265±0.0503172 |
| Z-Score: |
-2.4975±1.6533 |
| p-Value: |
0.0921468 |
| Z-Factor: |
-1.68942 |
| Fitness Defect: |
2.3844 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 9|E5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.40 Celcius | | Date: | 2005-11-29 YYYY-MM-DD | | Plate CH Control (+): | 0.03925±0.00101 | | Plate DMSO Control (-): | 0.46482500000000004±0.00717 | | Plate Z-Factor: | 0.9452 |
|  png
ps
pdf |
| DBLink | Rows returned: 5 | |
| 3703 |
3-(3,4-dichlorophenyl)-N-methyl-2,3-dihydro-1H-inden-1-amine |
| 126280 |
(1R,3R)-3-(3,4-dichlorophenyl)-N-methyl-2,3-dihydro-1H-inden-1-amine |
| 2794225 |
(1S,3S)-3-(3,4-dichlorophenyl)-N-methyl-2,3-dihydro-1H-inden-1-amine |
| 3020938 |
3-(3,4-dichlorophenyl)-N-methyl-2,3-dihydro-1H-inden-1-amine hydrochloride |
| 6604886 |
(1R,3S)-3-(3,4-dichlorophenyl)-N-methyl-2,3-dihydro-1H-inden-1-amine |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 1690 | Additional Members: 4 | Rows returned: 3 | |
|
