| Compound Information | SONAR Target prediction |
| Name: | Prochlorperazine dimaleate |
| Unique Identifier: | LOPAC 00300 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C28ClH32N3O8S |
| Molecular Weight: | 573.834 g/mol |
| X log p: | 16.724 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 35.02 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 3 |
| Rotatable Bond Count: | 4 |
| Canonical Smiles: | CN1CCN(CCCN2c3ccccc3Sc3ccc(Cl)cc23)CC1.OC(=O)C=CC(O)=O.OC(=O)C=CC(O)=O |
| Class: | Dopamine |
| Action: | Antagonist |
| Found: 1 active | as graph: single | with analogs |
| Species: | 4932 |
| Condition: | WHI5 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.4169±0.040093 |
| Normalized OD Score: sc h | 0.6516±0.0550338 |
| Z-Score: | -10.6336±2.93069 |
| p-Value: | 5.57934e-18 |
| Z-Factor: | -0.352503 |
| Fitness Defect: | 39.7275 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 6 |
| 66010 | but-2-enedioic acid; 2-chloro-10-[3-(4-methylpiperazin-1-yl)propyl]phenothiazine |
| 5281032 | but-2-enedioic acid; 2-chloro-10-[3-(4-methylpiperazin-1-yl)propyl]phenothiazine |
| 5462338 | but-2-enedioic acid; 2-chloro-10-[3-(4-methylpiperazin-1-yl)propyl]phenothiazine |
| 5462695 | 2-chloro-10-[3-(4-methyl-2,3,5,6-tetrahydropyrazin-1-yl)propyl]phenothiazine; (E)-4-hydroxy-4-oxo-but-2-enoate |
| 6436057 | but-2-enedioic acid; 2-chloro-10-[3-(4-methylpiperazin-1-yl)propyl]phenothiazine |
| 6537213 | but-2-enedioic acid; 2-chloro-10-[3-(4-methylpiperazin-1-yl)propyl]phenothiazine |
| internal high similarity DBLink | Rows returned: 0 |
| nonactive | Cluster 6041 | Additional Members: 22 | Rows returned: 19 | 1 2 3 4 Next >> |
| Prest853 | 0.555555555555556 |
| LAT002B04 | 0.5375 |
| SPE01500575 | 0.5375 |
| Prest437 | 0.5375 |
| LOPAC 00320 | 0.5375 |
| SPE01503936 | 0.452054794520548 |
Service provided by the
Mike Tyers Laboratory