| Compound Information | SONAR Target prediction |
| Name: | JL-18 |
| Unique Identifier: | LOPAC 00288 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C18H21N5 |
| Molecular Weight: | 286.226 g/mol |
| X log p: | 12.806 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 31.2 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 1 |
| Canonical Smiles: | CN1CCN(CC1)C1=Nc2cccnc2Nc2ccc(C)cc21 |
| Class: | Dopamine |
| Action: | Antagonist |
| Selectivity: | D4>D2 |
| Found: 24 nonactive as graph: single | with analogs | [1] << Back 1 2 3 4 5 6 7 8 9 10 Next >> [24] |
| Species: | 4932 |
| Condition: | HOC1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.5856±0.0272943 |
| Normalized OD Score: sc h | 1.0047±0.0303463 |
| Z-Score: | 0.2801±1.41812 |
| p-Value: | 0.33471 |
| Z-Factor: | -19.987 |
| Fitness Defect: | 1.0945 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 1 |
| 3802 |
| internal high similarity DBLink | Rows returned: 0 |
| nonactive | Cluster 6723 | Additional Members: 4 | Rows returned: 3 |
| LOPAC 00254 | 0 |
| SPE01500685 | 0 |
| Prest693 | 0 |
Service provided by the
Mike Tyers Laboratory