Compound Information | SONAR Target prediction | Name: | Amfonelic acid | Unique Identifier: | LOPAC 00271 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C18H16N2O3 | Molecular Weight: | 292.204 g/mol | X log p: | 15.79 (online calculus) | Lipinksi Failures | 1 | TPSA | 49.74 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 4 | Canonical Smiles: | CCN1C=C(C(O)=O)C(=O)c2ccc(Cc3ccccc3)nc12 | Class: | Dopamine | Action: | Modulator |
Species: |
4932 |
Condition: |
NOP16 |
Replicates: |
2 |
Raw OD Value: r im |
0.6895±0.000424264 |
Normalized OD Score: sc h |
0.9640±0.00509871 |
Z-Score: |
-1.6671±0.0405663 |
p-Value: |
0.095637 |
Z-Factor: |
-5.05115 |
Fitness Defect: |
2.3472 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 6|B7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-04-22 YYYY-MM-DD | Plate CH Control (+): | 0.044525±0.00099 | Plate DMSO Control (-): | 0.69415±0.03053 | Plate Z-Factor: | 0.8603 |
| png ps pdf |
DBLink | Rows returned: 1 | |
2137 |
7-benzyl-1-ethyl-4-oxo-1,8-naphthyridine-3-carboxylic acid |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 13339 | Additional Members: 8 | Rows returned: 3 | |
|