| Compound Information | SONAR Target prediction | | Name: | Amfonelic acid | | Unique Identifier: | LOPAC 00271 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C18H16N2O3 | | Molecular Weight: | 292.204 g/mol | | X log p: | 15.79 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 49.74 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CCN1C=C(C(O)=O)C(=O)c2ccc(Cc3ccccc3)nc12 | | Class: | Dopamine | | Action: | Modulator |
| Species: |
4932 |
| Condition: |
NOP16 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6895±0.000424264 |
| Normalized OD Score: sc h |
0.9640±0.00509871 |
| Z-Score: |
-1.6671±0.0405663 |
| p-Value: |
0.095637 |
| Z-Factor: |
-5.05115 |
| Fitness Defect: |
2.3472 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 6|B7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-04-22 YYYY-MM-DD | | Plate CH Control (+): | 0.044525±0.00099 | | Plate DMSO Control (-): | 0.69415±0.03053 | | Plate Z-Factor: | 0.8603 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 2137 |
7-benzyl-1-ethyl-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 13339 | Additional Members: 8 | Rows returned: 3 | |
|