Compound Information | SONAR Target prediction | Name: | Amfonelic acid | Unique Identifier: | LOPAC 00271 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C18H16N2O3 | Molecular Weight: | 292.204 g/mol | X log p: | 15.79 (online calculus) | Lipinksi Failures | 1 | TPSA | 49.74 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 4 | Canonical Smiles: | CCN1C=C(C(O)=O)C(=O)c2ccc(Cc3ccccc3)nc12 | Class: | Dopamine | Action: | Modulator |
Species: |
4932 |
Condition: |
MRC1 |
Replicates: |
2 |
Raw OD Value: r im |
0.8509±0.00968736 |
Normalized OD Score: sc h |
1.0149±0.00888589 |
Z-Score: |
1.0567±0.546194 |
p-Value: |
0.325814 |
Z-Factor: |
-4.83144 |
Fitness Defect: |
1.1214 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 6|B7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.00 Celcius | Date: | 2005-12-06 YYYY-MM-DD | Plate CH Control (+): | 0.039575±0.00096 | Plate DMSO Control (-): | 0.8067±0.01431 | Plate Z-Factor: | 0.9336 |
| png ps pdf |
DBLink | Rows returned: 1 | |
2137 |
7-benzyl-1-ethyl-4-oxo-1,8-naphthyridine-3-carboxylic acid |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 13339 | Additional Members: 8 | Rows returned: 5 | |
|