Compound Information | SONAR Target prediction | Name: | Dipropyldopamine hydrobromide | Unique Identifier: | LOPAC 00268 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | BrC14H24NO2 | Molecular Weight: | 294.059 g/mol | X log p: | 6.967 (online calculus) | Lipinksi Failures | 1 | TPSA | 3.24 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 7 | Canonical Smiles: | Br.CCCN(CCC)CCc1ccc(O)c(O)c1 | Class: | Dopamine | Action: | Agonist |
Species: |
4932 |
Condition: |
GAS1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6814±0.00438406 |
Normalized OD Score: sc h |
0.9953±0.00496118 |
Z-Score: |
-0.2241±0.23807 |
p-Value: |
0.825102 |
Z-Factor: |
-6.20521 |
Fitness Defect: |
0.1922 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 6|G6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.30 Celcius | Date: | 2005-11-17 YYYY-MM-DD | Plate CH Control (+): | 0.0397±0.00176 | Plate DMSO Control (-): | 0.678775±0.00985 | Plate Z-Factor: | 0.9529 |
| png ps pdf |
DBLink | Rows returned: 1 | |
3106 |
4-[2-(dipropylamino)ethyl]benzene-1,2-diol |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 5045 | Additional Members: 7 | Rows returned: 6 | |
|