| Compound Information | SONAR Target prediction | | Name: | Dipropyldopamine hydrobromide | | Unique Identifier: | LOPAC 00268 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | BrC14H24NO2 | | Molecular Weight: | 294.059 g/mol | | X log p: | 6.967 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 3.24 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | Br.CCCN(CCC)CCc1ccc(O)c(O)c1 | | Class: | Dopamine | | Action: | Agonist |
| Species: |
4932 |
| Condition: |
BY4743 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8432±0.222527 |
| Normalized OD Score: sc h |
1.0363±0.0213477 |
| Z-Score: |
0.9831±0.539969 |
| p-Value: |
0.359972 |
| Z-Factor: |
-3.25937 |
| Fitness Defect: |
1.0217 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 6|G6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-08-19 YYYY-MM-DD | | Plate CH Control (+): | 0.046024999999999996±0.00128 | | Plate DMSO Control (-): | 0.812075±0.02313 | | Plate Z-Factor: | 0.9303 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 3106 |
4-[2-(dipropylamino)ethyl]benzene-1,2-diol |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 5045 | Additional Members: 7 | Rows returned: 6 | |
|