Compound Information | SONAR Target prediction | Name: | Clozapine | Unique Identifier: | LOPAC 00254 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C18ClH19N4 | Molecular Weight: | 307.672 g/mol | X log p: | 15.894 (online calculus) | Lipinksi Failures | 1 | TPSA | 18.84 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 1 | Canonical Smiles: | CN1CCN(CC1)C1=Nc2cc(Cl)ccc2Nc2ccccc21 | Class: | Dopamine | Action: | Antagonist | Selectivity: | D4 > D2,D3 |
Species: |
4932 |
Condition: |
NUM1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7571±0.0334462 |
Normalized OD Score: sc h |
0.9910±0.023945 |
Z-Score: |
-0.4823±1.41783 |
p-Value: |
0.370244 |
Z-Factor: |
-264.253 |
Fitness Defect: |
0.9936 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 4|D7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.90 Celcius | Date: | 2005-11-30 YYYY-MM-DD | Plate CH Control (+): | 0.03945±0.00193 | Plate DMSO Control (-): | 0.757625±0.01906 | Plate Z-Factor: | 0.9670 |
| png ps pdf |
DBLink | Rows returned: 0 | |
internal high similarity DBLink | Rows returned: 1 | |
nonactive | Cluster 6723 | Additional Members: 4 | Rows returned: 3 | |
|