| Compound Information | SONAR Target prediction |
| Name: | Succinylcholine chloride |
| Unique Identifier: | LOPAC 00233 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C14Cl2H32N2O4 |
| Molecular Weight: | 331.066 g/mol |
| X log p: | 0.012 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 52.6 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 4 |
| Rotatable Bond Count: | 11 |
| Canonical Smiles: | [ClH-].[ClH-].C[N+](C)(C)CCOC(=O)CCC(=O)OCC[N+](C)(C)C |
| Class: | Cholinergic |
| Action: | Antagonist |
| Selectivity: | Nicotinic |
| Generic_name: | Succinylcholine |
| Chemical_iupac_name: | trimethyl-[2-[3-(2-trimethylammonioethoxycarbonyl)propanoyloxy]ethyl]ammonium |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA451522 |
| Kegg_compound_id: | C07546 |
| Drugbank_id: | APRD00159 |
| Cas_registry_number: | 306-40-1 |
| Drug_category: | Neuromuscular Depolarizing Agents; Skeletal Muscle Relaxants; ATC:M03BX |
| Indication: | Used in surgical procedures where a rapid onset and brief duration of muscle relaxation is needed (includes intubation, endoscopies, and ECT) |
| Pharmacology: | Succinylcholine is indicated as an adjunct to general anesthesia, to facilitate tracheal intubation, and to provide skeletal muscle relaxation during surgery or mechanical ventilation. Succinylcholine is a depolarizing skeletal muscle relaxant. As does acetylcholine, it combines with the cholinergic receptors of the motor end plate to produce depolarization. This depolarization may be observed as fasciculations. Subsequent neuromuscular transmission is inhibited so long as adequate concentration of succinylcholine remains at the receptor site. Succinylcholine has no direct action on the uterus or other smooth muscle structures. |
| Mechanism_of_action: | The mechanism of action of Succinylcholine involves what appears to be a "persistent" depolarization of the neuromuscular junction. This depolarization is caused by Succinylcholine mimicking the effect of acetylcholine but without being rapidly hydrolysed by acetylcholinesterase. This depolarization leads to desensitization. |
| Organisms_affected: | Humans and other mammals |
| Found: 24 nonactive as graph: single | with analogs | [1] << Back 21 22 23 24 |
| Species: | 4932 |
| Condition: | WHI5 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6292±0.000707107 |
| Normalized OD Score: sc h | 1.0189±0.0060079 |
| Z-Score: | 0.5815±0.250259 |
| p-Value: | 0.567026 |
| Z-Factor: | -3.66333 |
| Fitness Defect: | 0.5674 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 14 | 1 2 3 Next >> |
| 5314 | trimethyl-[2-[3-(2-trimethylammonioethoxycarbonyl)propanoyloxy]ethyl]azanium |
| 22475 | trimethyl-[2-[3-(2-trimethylammonioethoxycarbonyl)propanoyloxy]ethyl]azanium dichloride |
| 66129 | trimethyl-[2-[3-(2-trimethylammonioethoxycarbonyl)propanoyloxy]ethyl]azanium dibromide |
| 68325 | trimethyl-[2-[3-(2-trimethylammonioethoxycarbonyl)propanoyloxy]ethyl]azanium diiodide |
| 87986 | bis(2-dimethylaminoethyl) butanedioate |
| 116947 | 4-(2-dimethylaminoethoxy)-4-oxo-butanoic acid |
| internal high similarity DBLink | Rows returned: 0 |
| nonactive | Cluster 239 | Additional Members: 7 | Rows returned: 6 |
| LOPAC 00209 | 0.5 |
| LOPAC 00736 | 0.451612903225806 |
| SPE01500104 | 0.428571428571429 |
| SPE01500158 | 0 |
| Prest1036 | 0 |
| LOPAC 00183 | 0 |
Service provided by the
Mike Tyers Laboratory