| Compound Information | SONAR Target prediction | | Name: | (±)-Methoxyverapamil hydrochloride | | Unique Identifier: | LOPAC 00208 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C28ClH41N2O5 | | Molecular Weight: | 479.763 g/mol | | X log p: | 12.161 (online calculus) | | Lipinksi Failures | 2 | | TPSA | 73.18 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 7 | | Rotatable Bond Count: | 14 | | Canonical Smiles: | Cl.COc1ccc(CCN(C)CCCC(C#N)(C(C)C)c2cc(OC)c(OC)c(OC)c2)cc1OC | | Class: | Ca2+ Channel | | Action: | Antagonist | | Selectivity: | L-type |
| Species: |
4932 |
| Condition: |
GIM3 |
| Replicates: |
4 |
| Raw OD Value: r im |
0.5000±0.0745784 |
| Normalized OD Score: sc h |
1.0198±0.0470122 |
| Z-Score: |
0.4002±0.83808 |
| p-Value: |
0.512566 |
| Z-Factor: |
-5.13853 |
| Fitness Defect: |
0.6683 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 10|F9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.70 Celcius | | Date: | 2005-04-08 YYYY-MM-DD | | Plate CH Control (+): | 0.0449625±0.00068 | | Plate DMSO Control (-): | 0.6567000000000002±0.13731 | | Plate Z-Factor: | -0.1642 |
| png ps pdf |
| 6603929 |
(2S)-5-[2-(3,4-dimethoxyphenyl)ethyl-methyl-amino]-2-propan-2-yl-2-(3,4,5-trimethoxyphenyl)pentanenitril e |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 3209 | Additional Members: 11 | Rows returned: 0 | |
|