| Compound Information | SONAR Target prediction |  | Name: | (±)-Methoxyverapamil hydrochloride |  | Unique Identifier: | LOPAC 00208  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C28ClH41N2O5 |  | Molecular Weight: | 479.763 g/mol |  | X log p: | 12.161  (online calculus) |  | Lipinksi Failures | 2 |  | TPSA | 73.18 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 7 |  | Rotatable Bond Count: | 14 |  | Canonical Smiles: | Cl.COc1ccc(CCN(C)CCCC(C#N)(C(C)C)c2cc(OC)c(OC)c(OC)c2)cc1OC |  | Class: | Ca2+ Channel |  | Action: | Antagonist |  | Selectivity: | L-type |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		ESC2 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.4500±0.0183141 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9702±0.0232046 | 
	 
	
		| Z-Score: | 
		-0.9510±0.78122 | 
	 
	
		| p-Value: | 
		0.411468 | 
	 
	
		| Z-Factor: | 
		-3.61739 | 
	 
	
		| Fitness Defect: | 
		0.888 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Lopac |  | Plate Number and Position: | 10|F9 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 28.30 Celcius |  | Date: | 2005-11-25 YYYY-MM-DD |  | Plate CH Control (+): | 0.039150000000000004±0.00155 |  | Plate DMSO Control (-): | 0.4617±0.01624 |  | Plate Z-Factor: | 0.8683 |  
  |  png ps pdf |  
 
 
	
		| 6603929 | 
		(2S)-5-[2-(3,4-dimethoxyphenyl)ethyl-methyl-amino]-2-propan-2-yl-2-(3,4,5-trimethoxyphenyl)pentanenitril e | 
	 
 
 | internal high similarity DBLink  | Rows returned: 3 |  |   
 |  active | Cluster 3209 | Additional Members: 11 | Rows returned: 0 |  |  
  
 |