| Compound Information | SONAR Target prediction | | Name: | (±)-Methoxyverapamil hydrochloride | | Unique Identifier: | LOPAC 00208 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C28ClH41N2O5 | | Molecular Weight: | 479.763 g/mol | | X log p: | 12.161 (online calculus) | | Lipinksi Failures | 2 | | TPSA | 73.18 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 7 | | Rotatable Bond Count: | 14 | | Canonical Smiles: | Cl.COc1ccc(CCN(C)CCCC(C#N)(C(C)C)c2cc(OC)c(OC)c(OC)c2)cc1OC | | Class: | Ca2+ Channel | | Action: | Antagonist | | Selectivity: | L-type |
| Species: |
4932 |
| Condition: |
TEP1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6022±0.00933381 |
| Normalized OD Score: sc h |
1.0193±0.00094515 |
| Z-Score: |
0.7675±0.0881652 |
| p-Value: |
0.443672 |
| Z-Factor: |
-1.92888 |
| Fitness Defect: |
0.8127 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 10|F9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-05-17 YYYY-MM-DD | | Plate CH Control (+): | 0.045975±0.00652 | | Plate DMSO Control (-): | 0.574525±0.01107 | | Plate Z-Factor: | 0.8764 |
| png ps pdf |
| 6603929 |
(2S)-5-[2-(3,4-dimethoxyphenyl)ethyl-methyl-amino]-2-propan-2-yl-2-(3,4,5-trimethoxyphenyl)pentanenitril e |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 3209 | Additional Members: 11 | Rows returned: 0 | |
|