Compound Information | SONAR Target prediction | Name: | Flunarizine dihydrochloride | Unique Identifier: | LOPAC 00190 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C26Cl2F2H28N2 | Molecular Weight: | 449.194 g/mol | X log p: | 32.214 (online calculus) | Lipinksi Failures | 1 | TPSA | 6.48 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 6 | Canonical Smiles: | Cl.Cl.Fc1ccc(cc1)C(N1CCN(CC1)CC=Cc1ccccc1)c1ccc(F)cc1 | Class: | Ion Pump | Action: | Blocker | Selectivity: | Na+/Ca2+ channel |
Species: |
4932 |
Condition: |
NUM1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7010±0.0120915 |
Normalized OD Score: sc h |
0.9248±0.00546166 |
Z-Score: |
-4.6043±0.107286 |
p-Value: |
0.00000440368 |
Z-Factor: |
0.468826 |
Fitness Defect: |
12.3331 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 7|E8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.90 Celcius | Date: | 2005-11-30 YYYY-MM-DD | Plate CH Control (+): | 0.038825±0.00100 | Plate DMSO Control (-): | 0.73985±0.00613 | Plate Z-Factor: | 0.9730 |
| png ps pdf |
5353625 |
1-[bis(4-fluorophenyl)methyl]-4-cinnamyl-2,3,5,6-tetrahydropyrazine |
5388974 |
1-[bis(4-fluorophenyl)methyl]-4-cinnamyl-piperazine; hydrogen(+1) cation; chloride |
6365505 |
1-[bis(4-fluorophenyl)methyl]-4-cinnamyl-piperazine hydrochloride |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 3056 | Additional Members: 6 | Rows returned: 2 | |
|