| Compound Information | SONAR Target prediction | | Name: | Flunarizine dihydrochloride | | Unique Identifier: | LOPAC 00190 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C26Cl2F2H28N2 | | Molecular Weight: | 449.194 g/mol | | X log p: | 32.214 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 6.48 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | Cl.Cl.Fc1ccc(cc1)C(N1CCN(CC1)CC=Cc1ccccc1)c1ccc(F)cc1 | | Class: | Ion Pump | | Action: | Blocker | | Selectivity: | Na+/Ca2+ channel |
| Species: |
4932 |
| Condition: |
BY4741 |
| Replicates: |
8 |
| Raw OD Value: r im |
0.9038±0.142063 |
| Normalized OD Score: sc h |
1.1300±0.0824742 |
| Z-Score: |
3.4808±2.50693 |
| p-Value: |
0.0006926 |
| Z-Factor: |
-2.17719 |
| Fitness Defect: |
7.2751 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 7|E8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.70 Celcius | | Date: | 2005-04-07 YYYY-MM-DD | | Plate CH Control (+): | 0.04673125000000002±0.00247 | | Plate DMSO Control (-): | 0.7753±0.04573 | | Plate Z-Factor: | 0.8612 |
| png ps pdf |
| 5353625 |
1-[bis(4-fluorophenyl)methyl]-4-cinnamyl-2,3,5,6-tetrahydropyrazine |
| 5388974 |
1-[bis(4-fluorophenyl)methyl]-4-cinnamyl-piperazine; hydrogen(+1) cation; chloride |
| 6365505 |
1-[bis(4-fluorophenyl)methyl]-4-cinnamyl-piperazine hydrochloride |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 3056 | Additional Members: 6 | Rows returned: 2 | |
|