| Compound Information | SONAR Target prediction |
| Name: | Carbachol |
| Unique Identifier: | LOPAC 00183 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C6ClH16N2O2 |
| Molecular Weight: | 167.529 g/mol |
| X log p: | 0.119 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 26.3 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 3 |
| Rotatable Bond Count: | 4 |
| Canonical Smiles: | [ClH-].C[N+](C)(C)CCOC(N)=O |
| Class: | Cholinergic |
| Action: | Agonist |
| Generic_name: | Carbachol |
| Chemical_iupac_name: | 2-carbamoyloxyethyl-trimethyl-ammonium |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA448784 |
| Kegg_compound_id: | D00524 |
| Drugbank_id: | APRD00845 |
| Melting_point: | 210 oC |
| H2o_solubility: | 1 g/ml |
| Logp: | -3.78 |
| Cas_registry_number: | 51-83-2 |
| Mass_spectrum: | http://webbook.nist.gov/cgi/cbook.cgi?Spec=C51832&Index=0&Type=Mass&Large=on |
| Drug_category: | Analgesics, Non-Narcotic; Cardiotonic Agents; Cholinergic Agonists; Miotics; ATC:N07AB01; ATC:S01EB02 |
| Indication: | Primarily used in the treatment of glaucoma, but is also used during ophthalmic surgery. |
| Pharmacology: | Carbachol is a potent cholinergic (parasympathomimetic) agent which produces constriction of the iris and ciliary body resulting in reduction in intraocular pressure. The exact mechanism by which carbachol lowers intraocular pressure is not precisely known. In the cat and rat, carbachol is well-known for its ability to induce rapid eye movement (REM) sleep when microinjected into the pontine reticular formation. Carbachol elicits this REM sleep-like state via activation of postsynaptic muscarinic cholinergic receptors (mAChRs). |
| Mechanism_of_action: | Carbachol is a parasympathomimetic that stimulates both muscarinic and nicotinic receptors. In topical ocular and intraocular administration its principal effects are miosis and increased aqueous humour outflow. |
| Organisms_affected: | Humans and other mammals |
| Found: 24 nonactive as graph: single | with analogs | [1] << Back 11 12 13 14 15 16 17 18 19 20 Next >> [24] |
| Species: | 4932 |
| Condition: | LGE1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.5076±0.0410829 |
| Normalized OD Score: sc h | 0.9995±0.00881471 |
| Z-Score: | -0.0137±0.302025 |
| p-Value: | 0.830902 |
| Z-Factor: | -47.8533 |
| Fitness Defect: | 0.1852 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 7 | << Back 1 2 |
| 521353 | 2-carbamoyloxyethyl-trimethyl-azanium chloride |
| internal high similarity DBLink | Rows returned: 1 |
| SPE01500158 | 1.0000 |
| active | Cluster 239 | Additional Members: 7 | Rows returned: 2 |
| LOPAC 00736 | 0.451612903225806 |
| SPE01500104 | 0.428571428571429 |
Service provided by the
Mike Tyers Laboratory