Compound Information | SONAR Target prediction | Name: | Benztropine mesylate | Unique Identifier: | LOPAC 00174 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C22H29NO4S | Molecular Weight: | 374.306 g/mol | X log p: | 20.956 (online calculus) | Lipinksi Failures | 1 | TPSA | 12.47 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 4 | Canonical Smiles: | CN1C2CCC1CC(C2)OC(c1ccccc1)c1ccccc1.CS(O)(=O)=O | Class: | Cholinergic | Action: | Antagonist | Selectivity: | Muscarinic |
Species: |
4932 |
Condition: |
KRE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6318±0.0290621 |
Normalized OD Score: sc h |
0.9972±0.00837811 |
Z-Score: |
-0.1146±0.353582 |
p-Value: |
0.803838 |
Z-Factor: |
-19.3613 |
Fitness Defect: |
0.2184 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 3|D5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.80 Celcius | Date: | 2005-11-22 YYYY-MM-DD | Plate CH Control (+): | 0.0385±0.00125 | Plate DMSO Control (-): | 0.6206499999999999±0.00970 | Plate Z-Factor: | 0.9518 |
| png ps pdf |
5771553 |
(1S,5S)-3-benzhydryloxy-8-methyl-8-azabicyclo[3.2.1]octane; methanesulfonic acid |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 2609 | Additional Members: 7 | Rows returned: 2 | |
|