| Compound Information | SONAR Target prediction | | Name: | YS-035 hydrochloride | | Unique Identifier: | LOPAC 00162 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C21ClH30NO4 | | Molecular Weight: | 365.682 g/mol | | X log p: | 14.329 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 40.16 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 10 | | Canonical Smiles: | Cl.COc1ccc(CCN(C)CCc2ccc(OC)c(OC)c2)cc1OC | | Class: | Ca2+ Channel | | Action: | Blocker | | Selectivity: | L-type |
| Species: |
4932 |
| Condition: |
CLN3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7647±0.0265872 |
| Normalized OD Score: sc h |
1.0831±0.0454509 |
| Z-Score: |
3.0205±2.05501 |
| p-Value: |
0.0585164 |
| Z-Factor: |
-3.04957 |
| Fitness Defect: |
2.8384 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 16|B11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.90 Celcius | | Date: | 2005-05-08 YYYY-MM-DD | | Plate CH Control (+): | 0.050574999999999995±0.00185 | | Plate DMSO Control (-): | 0.6905749999999999±0.07499 | | Plate Z-Factor: | 0.8044 |
| png ps pdf |
| 5714 |
2-(3,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-ethanamine |
| 5715 |
bis[2-(3,4-dimethoxyphenyl)ethyl]-methyl-azanium |
| 29748 |
bis[2-(3,4-dimethoxyphenyl)ethyl]azanium chloride |
| 29749 |
2-(3,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]ethanamine |
| 56017 |
bis[2-(3,4-dimethoxyphenyl)ethyl]-methyl-azanium chloride |
| 215355 |
2-(3,4-dimethoxyphenyl)-N-phenethyl-ethanamine hydrochloride |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 3209 | Additional Members: 11 | Rows returned: 4 | |
|