| Compound Information | SONAR Target prediction |  | Name: | YS-035 hydrochloride |  | Unique Identifier: | LOPAC 00162  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C21ClH30NO4 |  | Molecular Weight: | 365.682 g/mol |  | X log p: | 14.329  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 40.16 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 10 |  | Canonical Smiles: | Cl.COc1ccc(CCN(C)CCc2ccc(OC)c(OC)c2)cc1OC |  | Class: | Ca2+ Channel |  | Action: | Blocker |  | Selectivity: | L-type |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		MRC1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.8143±0.00127279 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9984±0.00862943 | 
	 
	
		| Z-Score: | 
		-0.1445±0.641282 | 
	 
	
		| p-Value: | 
		0.653614 | 
	 
	
		| Z-Factor: | 
		-506.734 | 
	 
	
		| Fitness Defect: | 
		0.4252 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Lopac |  | Plate Number and Position: | 16|B11 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.00 Celcius |  | Date: | 2005-12-06 YYYY-MM-DD |  | Plate CH Control (+): | 0.040425±0.19140 |  | Plate DMSO Control (-): | 0.808925±0.00891 |  | Plate Z-Factor: | 0.9537 |  
  |  png ps pdf |  
 
 
	
		| 5714 | 
		2-(3,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-ethanamine | 
	 
	
		| 5715 | 
		bis[2-(3,4-dimethoxyphenyl)ethyl]-methyl-azanium | 
	 
	
		| 29748 | 
		bis[2-(3,4-dimethoxyphenyl)ethyl]azanium chloride | 
	 
	
		| 29749 | 
		2-(3,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]ethanamine | 
	 
	
		| 56017 | 
		bis[2-(3,4-dimethoxyphenyl)ethyl]-methyl-azanium chloride | 
	 
	
		| 215355 | 
		2-(3,4-dimethoxyphenyl)-N-phenethyl-ethanamine hydrochloride | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 3209 | Additional Members: 11 | Rows returned: 0 |  |  
  
 |